C21H17N5O7 — CID 55688425
ethyl 1-[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]pyrazole-3-carboxylate (PubChem CID 55688425) has the molecular formula C21H17N5O7 and a molecular weight of 451.40 g/mol. Its IUPAC name is ethyl 1-[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55688425 |
| Molecular Formula | C21H17N5O7 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | ethyl 1-[3-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2cccc(NC(=O)Cn3c(=O)oc4cc([N+](=O)[O-])ccc43)c2)n1 |
| InChI | InChI=1S/C21H17N5O7/c1-2-32-20(28)16-8-9-25(23-16)14-5-3-4-13(10-14)22-19(27)12-24-17-7-6-15(26(30)31)11-18(17)33-21(24)29/h3-11H,2,12H2,1H3,(H,22,27) |
| InChIKey | FWULKVRYBUVYDQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|