C16H19IN2OS — CID 78949828
N-[3-(diethylaminomethyl)phenyl]-5-iodothiophene-3-carboxamide (PubChem CID 78949828) has the molecular formula C16H19IN2OS and a molecular weight of 414.31 g/mol. Its IUPAC name is N-[3-(diethylaminomethyl)phenyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[3-(diethylaminomethyl)phenyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949828 |
| Molecular Formula | C16H19IN2OS |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[3-(diethylaminomethyl)phenyl]-5-iodothiophene-3-carboxamide |
| SMILES | CCN(CC)Cc1cccc(NC(=O)c2csc(I)c2)c1 |
| InChI | InChI=1S/C16H19IN2OS/c1-3-19(4-2)10-12-6-5-7-14(8-12)18-16(20)13-9-15(17)21-11-13/h5-9,11H,3-4,10H2,1-2H3,(H,18,20) |
| InChIKey | WTUGNAFDTCKVFV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|