C15H17IN2O2S — CID 79691493
N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-5-iodothiophene-3-carboxamide (PubChem CID 79691493) has the molecular formula C15H17IN2O2S and a molecular weight of 416.28 g/mol. Its IUPAC name is N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79691493 |
| Molecular Formula | C15H17IN2O2S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-5-iodothiophene-3-carboxamide |
| SMILES | CCN(CCO)c1ccc(NC(=O)c2csc(I)c2)cc1 |
| InChI | InChI=1S/C15H17IN2O2S/c1-2-18(7-8-19)13-5-3-12(4-6-13)17-15(20)11-9-14(16)21-10-11/h3-6,9-10,19H,2,7-8H2,1H3,(H,17,20) |
| InChIKey | SQIQXHUWVKTCIJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|