C10H11N3O2 — CID 82506823
5-amino-2-(2-aminoethyl)isoindole-1,3-dione (PubChem CID 82506823) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-amino-2-(2-aminoethyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(2-aminoethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 82506823 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-amino-2-(2-aminoethyl)isoindole-1,3-dione |
| SMILES | NCCN1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C10H11N3O2/c11-3-4-13-9(14)7-2-1-6(12)5-8(7)10(13)15/h1-2,5H,3-4,11-12H2 |
| InChIKey | AROMCTHSFSUUAQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|