C13H16N2O4S — CID 106724648
5-amino-2-(2-propan-2-ylsulfonylethyl)isoindole-1,3-dione (PubChem CID 106724648) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-amino-2-(2-propan-2-ylsulfonylethyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(2-propan-2-ylsulfonylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 106724648 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-amino-2-(2-propan-2-ylsulfonylethyl)isoindole-1,3-dione |
| SMILES | CC(C)S(=O)(=O)CCN1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C13H16N2O4S/c1-8(2)20(18,19)6-5-15-12(16)10-4-3-9(14)7-11(10)13(15)17/h3-4,7-8H,5-6,14H2,1-2H3 |
| InChIKey | BKAQDXMQUYAYQR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|