C13H15ClN2O4S — CID 113082296
N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]propane-1-sulfonamide (PubChem CID 113082296) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113082296 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCN1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C13H15ClN2O4S/c1-2-7-21(19,20)15-5-6-16-12(17)10-4-3-9(14)8-11(10)13(16)18/h3-4,8,15H,2,5-7H2,1H3 |
| InChIKey | RFOJNWZYFONHJG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|