C19H17ClN2O4 — CID 113082264
N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 113082264) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113082264 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCN2C(=O)c3ccc(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-26-14-5-2-12(3-6-14)10-17(23)21-8-9-22-18(24)15-7-4-13(20)11-16(15)19(22)25/h2-7,11H,8-10H2,1H3,(H,21,23) |
| InChIKey | SXFXALJMEJNYCQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|