C15H18ClN3O3 — CID 113202264
3-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 113202264) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 3-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | 3-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 113202264 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | CN(C)CCNC(=O)CCN1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C15H18ClN3O3/c1-18(2)8-6-17-13(20)5-7-19-14(21)11-4-3-10(16)9-12(11)15(19)22/h3-4,9H,5-8H2,1-2H3,(H,17,20) |
| InChIKey | VLJKWLDTTZRGEK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|