C15H13ClN2O4S2 — CID 113082311
N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 113082311) has the molecular formula C15H13ClN2O4S2 and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113082311 |
| Molecular Formula | C15H13ClN2O4S2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | N-[2-(5-chloro-1,3-dioxoisoindol-2-yl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCN2C(=O)c3ccc(Cl)cc3C2=O)s1 |
| InChI | InChI=1S/C15H13ClN2O4S2/c1-9-2-5-13(23-9)24(21,22)17-6-7-18-14(19)11-4-3-10(16)8-12(11)15(18)20/h2-5,8,17H,6-7H2,1H3 |
| InChIKey | BAGHJGKCCYNSBA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|