C13H10ClN3O4S2 — CID 113082213
5-chloro-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 113082213) has the molecular formula C13H10ClN3O4S2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113082213 |
| Molecular Formula | C13H10ClN3O4S2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 5-chloro-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1CCNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10ClN3O4S2/c14-9-3-4-10(22-9)23(20,21)16-6-7-17-12(18)8-2-1-5-15-11(8)13(17)19/h1-5,16H,6-7H2 |
| InChIKey | HRJGTDODQFLIKP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|