C18H17N3O4S — CID 121022937
(E)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-2-(4-methylphenyl)ethenesulfonamide (PubChem CID 121022937) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is (E)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-2-(4-methylphenyl)ethenesulfonamide.
| Compound Name | (E)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-2-(4-methylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 121022937 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (E)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]-2-(4-methylphenyl)ethenesulfonamide |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)NCCN2C(=O)c3cccnc3C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-13-4-6-14(7-5-13)8-12-26(24,25)20-10-11-21-17(22)15-3-2-9-19-16(15)18(21)23/h2-9,12,20H,10-11H2,1H3/b12-8+ |
| InChIKey | BBEBHRUFOLTJAK-XYOKQWHBSA-N |
| XLogP | 1.58 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|