C16H11N2O5- — CID 8545542
2-[5-(3-aminophenoxy)-1,3-dioxoisoindol-2-yl]acetate (PubChem CID 8545542) has the molecular formula C16H11N2O5- and a molecular weight of 311.27 g/mol. Its IUPAC name is 2-[5-(3-aminophenoxy)-1,3-dioxoisoindol-2-yl]acetate.
| Compound Name | 2-[5-(3-aminophenoxy)-1,3-dioxoisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 8545542 |
| Molecular Formula | C16H11N2O5- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[5-(3-aminophenoxy)-1,3-dioxoisoindol-2-yl]acetate |
| SMILES | Nc1cccc(Oc2ccc3c(c2)C(=O)N(CC(=O)[O-])C3=O)c1 |
| InChI | InChI=1S/C16H12N2O5/c17-9-2-1-3-10(6-9)23-11-4-5-12-13(7-11)16(22)18(15(12)21)8-14(19)20/h1-7H,8,17H2,(H,19,20)/p-1 |
| InChIKey | ZVHNSDWXHNEEJB-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|