C23H16NO5- — CID 3519154
4-[1,3-dioxo-2-(1-phenylethyl)isoindol-5-yl]oxybenzoate (PubChem CID 3519154) has the molecular formula C23H16NO5- and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-[1,3-dioxo-2-(1-phenylethyl)isoindol-5-yl]oxybenzoate.
| Compound Name | 4-[1,3-dioxo-2-(1-phenylethyl)isoindol-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 3519154 |
| Molecular Formula | C23H16NO5- |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-[1,3-dioxo-2-(1-phenylethyl)isoindol-5-yl]oxybenzoate |
| SMILES | CC(c1ccccc1)N1C(=O)c2ccc(Oc3ccc(C(=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C23H17NO5/c1-14(15-5-3-2-4-6-15)24-21(25)19-12-11-18(13-20(19)22(24)26)29-17-9-7-16(8-10-17)23(27)28/h2-14H,1H3,(H,27,28)/p-1 |
| InChIKey | YXHYOFGCOMQQIP-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|