C21H15NO5S — CID 10500776
2-[4-(4-methylphenyl)sulfonylphenoxy]isoindole-1,3-dione (PubChem CID 10500776) has the molecular formula C21H15NO5S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonylphenoxy]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-methylphenyl)sulfonylphenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10500776 |
| Molecular Formula | C21H15NO5S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonylphenoxy]isoindole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(ON3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H15NO5S/c1-14-6-10-16(11-7-14)28(25,26)17-12-8-15(9-13-17)27-22-20(23)18-4-2-3-5-19(18)21(22)24/h2-13H,1H3 |
| InChIKey | OUOCNOHRDTUYPR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|