C16H13NO8S2 — CID 139968026
(2,5-dioxopyrrolidin-1-yl) 4-(benzenesulfonyloxy)benzenesulfonate (PubChem CID 139968026) has the molecular formula C16H13NO8S2 and a molecular weight of 411.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(benzenesulfonyloxy)benzenesulfonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(benzenesulfonyloxy)benzenesulfonate |
|---|---|
| PubChem CID | 139968026 |
| Molecular Formula | C16H13NO8S2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(benzenesulfonyloxy)benzenesulfonate |
| SMILES | O=C1CCC(=O)N1OS(=O)(=O)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13NO8S2/c18-15-10-11-16(19)17(15)25-27(22,23)14-8-6-12(7-9-14)24-26(20,21)13-4-2-1-3-5-13/h1-9H,10-11H2 |
| InChIKey | ZGWOTPGUZCRPJI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|