C15H13NO4S — CID 131868830
(2-oxo-3,4-dihydro-1H-quinolin-7-yl) benzenesulfonate (PubChem CID 131868830) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-7-yl) benzenesulfonate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) benzenesulfonate |
|---|---|
| PubChem CID | 131868830 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) benzenesulfonate |
| SMILES | O=C1CCc2ccc(OS(=O)(=O)c3ccccc3)cc2N1 |
| InChI | InChI=1S/C15H13NO4S/c17-15-9-7-11-6-8-12(10-14(11)16-15)20-21(18,19)13-4-2-1-3-5-13/h1-6,8,10H,7,9H2,(H,16,17) |
| InChIKey | CGACOJSSXBVPKE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|