C18H17N5O2 — CID 12941284
7-[(1-benzyltetrazol-5-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 12941284) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 7-[(1-benzyltetrazol-5-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[(1-benzyltetrazol-5-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 12941284 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 7-[(1-benzyltetrazol-5-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCc3nnnn3Cc3ccccc3)cc2N1 |
| InChI | InChI=1S/C18H17N5O2/c24-18-9-7-14-6-8-15(10-16(14)19-18)25-12-17-20-21-22-23(17)11-13-4-2-1-3-5-13/h1-6,8,10H,7,9,11-12H2,(H,19,24) |
| InChIKey | SESCXDOMMPMVGH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |