C14H12BrNO2S — CID 114939999
7-[(4-bromothiophen-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114939999) has the molecular formula C14H12BrNO2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 7-[(4-bromothiophen-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[(4-bromothiophen-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114939999 |
| Molecular Formula | C14H12BrNO2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 7-[(4-bromothiophen-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCc3cc(Br)cs3)cc2N1 |
| InChI | InChI=1S/C14H12BrNO2S/c15-10-5-12(19-8-10)7-18-11-3-1-9-2-4-14(17)16-13(9)6-11/h1,3,5-6,8H,2,4,7H2,(H,16,17) |
| InChIKey | XKLNIXRJVJSXTQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |