C12H14BrNO3 — CID 114939907
7-(3-bromo-2-hydroxypropoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114939907) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 7-(3-bromo-2-hydroxypropoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(3-bromo-2-hydroxypropoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114939907 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 7-(3-bromo-2-hydroxypropoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCC(O)CBr)cc2N1 |
| InChI | InChI=1S/C12H14BrNO3/c13-6-9(15)7-17-10-3-1-8-2-4-12(16)14-11(8)5-10/h1,3,5,9,15H,2,4,6-7H2,(H,14,16) |
| InChIKey | XWFKVINCGBQZEP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|