C21H17Br2NO5S — CID 98120910
[4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzenesulfonate (PubChem CID 98120910) has the molecular formula C21H17Br2NO5S and a molecular weight of 555.24 g/mol. Its IUPAC name is [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 98120910 |
| Molecular Formula | C21H17Br2NO5S |
| Molecular Weight | 555.24 g/mol |
| Exact Mass | 552.92 |
| IUPAC Name | [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@H]2[C@@H]3C[C@@H]([C@@H](Br)[C@H]3Br)[C@@H]2C(=O)N1c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17Br2NO5S/c22-18-14-10-15(19(18)23)17-16(14)20(25)24(21(17)26)11-6-8-12(9-7-11)29-30(27,28)13-4-2-1-3-5-13/h1-9,14-19H,10H2/t14-,15+,16-,17-,18-,19+/m0/s1 |
| InChIKey | ONGCVNVDCDIOOH-CABLIKTCSA-N |
| XLogP | 3.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|