C16H25NO5S — CID 174656480
piperidine-1-carboxylic acid;propan-2-yl 4-methylbenzenesulfonate (PubChem CID 174656480) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is piperidine-1-carboxylic acid;propan-2-yl 4-methylbenzenesulfonate.
| Compound Name | piperidine-1-carboxylic acid;propan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174656480 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | piperidine-1-carboxylic acid;propan-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)C)cc1.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C10H14O3S.C6H11NO2/c1-8(2)13-14(11,12)10-6-4-9(3)5-7-10;8-6(9)7-4-2-1-3-5-7/h4-8H,1-3H3;1-5H2,(H,8,9) |
| InChIKey | DKCOBAFSOXEFTC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|