About sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride
sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride (PubChem CID 175400890) has the molecular formula C4H6NNaO6S
and a molecular weight of 219.15 g/mol. Its IUPAC name is sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride.
Molecular Properties
| Compound Name | sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride |
| PubChem CID | 175400890 |
| Molecular Formula | C4H6NNaO6S |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride |
| SMILES | O=C1CCC(=O)N1OS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H5NO6S.Na.H/c6-3-1-2-4(7)5(3)11-12(8,9)10;;/h1-2H2,(H,8,9,10);;/q;+1;-1 |
| InChIKey | YCPXIPSCFBIFIM-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride?
The IUPAC name of sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride (CID 175400890) is sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride.
What is the SMILES notation for sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride?
The canonical SMILES for sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride is O=C1CCC(=O)N1OS(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride?
The InChIKey is YCPXIPSCFBIFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO6S.Na.H/c6-3-1-2-4(7)5(3)11-12(8,9)10;;/h1-2H2,(H,8,9,10);;/q;+1;-1.
What are the key properties of sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride?
sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride has a molecular weight of 219.15 g/mol, XLogP of -4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(2,5-dioxopyrrolidin-1-yl) hydrogen sulfate;hydride is sourced from PubChem (CID 175400890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).