(2-oxoazepan-1-yl) hydrogen sulfate

C6H11NO5S — CID 174726288

IUPAC(2-oxoazepan-1-yl) hydrogen sulfate
SMILESO=C1CCCCCN1OS(=O)(=O)O
InChIInChI=1S/C6H11NO5S/c8-6-4-2-1-3-5-7(6)12-13(9,10)11/h1-5H2,(H,9,10,11)
InChIKeyDQMAMXNOJZWESG-UHFFFAOYSA-N
MW209.22 g/mol
LogP0.12
Rot. Bonds2

About (2-oxoazepan-1-yl) hydrogen sulfate

(2-oxoazepan-1-yl) hydrogen sulfate (PubChem CID 174726288) has the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. Its IUPAC name is (2-oxoazepan-1-yl) hydrogen sulfate.

Molecular Properties

Compound Name(2-oxoazepan-1-yl) hydrogen sulfate
PubChem CID174726288
Molecular FormulaC6H11NO5S
Molecular Weight209.22 g/mol
Exact Mass209.04
IUPAC Name(2-oxoazepan-1-yl) hydrogen sulfate
SMILESO=C1CCCCCN1OS(=O)(=O)O
InChIInChI=1S/C6H11NO5S/c8-6-4-2-1-3-5-7(6)12-13(9,10)11/h1-5H2,(H,9,10,11)
InChIKeyDQMAMXNOJZWESG-UHFFFAOYSA-N
XLogP0.12
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.22
LogP ≤ 50.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2-oxoazepan-1-yl) hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxoazepan-1-yl) hydrogen sulfate?
The IUPAC name of (2-oxoazepan-1-yl) hydrogen sulfate (CID 174726288) is (2-oxoazepan-1-yl) hydrogen sulfate.
What is the SMILES notation for (2-oxoazepan-1-yl) hydrogen sulfate?
The canonical SMILES for (2-oxoazepan-1-yl) hydrogen sulfate is O=C1CCCCCN1OS(=O)(=O)O.
What is the InChIKey of (2-oxoazepan-1-yl) hydrogen sulfate?
The InChIKey is DQMAMXNOJZWESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO5S/c8-6-4-2-1-3-5-7(6)12-13(9,10)11/h1-5H2,(H,9,10,11).
What are the key properties of (2-oxoazepan-1-yl) hydrogen sulfate?
(2-oxoazepan-1-yl) hydrogen sulfate has a molecular weight of 209.22 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-1-yl) hydrogen sulfate is sourced from PubChem (CID 174726288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).