About (2-oxopyrrolidin-1-yl) formate;silver
(2-oxopyrrolidin-1-yl) formate;silver (PubChem CID 87555007) has the molecular formula C5H7AgNO3
and a molecular weight of 236.98 g/mol. Its IUPAC name is (2-oxopyrrolidin-1-yl) formate;silver.
Molecular Properties
| Compound Name | (2-oxopyrrolidin-1-yl) formate;silver |
| PubChem CID | 87555007 |
| Molecular Formula | C5H7AgNO3 |
| Molecular Weight | 236.98 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | (2-oxopyrrolidin-1-yl) formate;silver |
| SMILES | O=CON1CCCC1=O.[Ag] |
| InChI | InChI=1S/C5H7NO3.Ag/c7-4-9-6-3-1-2-5(6)8;/h4H,1-3H2; |
| InChIKey | WIDSYISLOYSZMZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.98 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-oxopyrrolidin-1-yl) formate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopyrrolidin-1-yl) formate;silver?
The IUPAC name of (2-oxopyrrolidin-1-yl) formate;silver (CID 87555007) is (2-oxopyrrolidin-1-yl) formate;silver.
What is the SMILES notation for (2-oxopyrrolidin-1-yl) formate;silver?
The canonical SMILES for (2-oxopyrrolidin-1-yl) formate;silver is O=CON1CCCC1=O.[Ag].
What is the InChIKey of (2-oxopyrrolidin-1-yl) formate;silver?
The InChIKey is WIDSYISLOYSZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3.Ag/c7-4-9-6-3-1-2-5(6)8;/h4H,1-3H2;.
What are the key properties of (2-oxopyrrolidin-1-yl) formate;silver?
(2-oxopyrrolidin-1-yl) formate;silver has a molecular weight of 236.98 g/mol, XLogP of -0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopyrrolidin-1-yl) formate;silver is sourced from PubChem (CID 87555007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).