C7H9NO7S3 — CID 57450732
3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1,1-bis(sulfanyl)propane-1-sulfonic acid (PubChem CID 57450732) has the molecular formula C7H9NO7S3 and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1,1-bis(sulfanyl)propane-1-sulfonic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1,1-bis(sulfanyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57450732 |
| Molecular Formula | C7H9NO7S3 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1,1-bis(sulfanyl)propane-1-sulfonic acid |
| SMILES | O=C(CC(S)(S)S(=O)(=O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO7S3/c9-4-1-2-5(10)8(4)15-6(11)3-7(16,17)18(12,13)14/h16-17H,1-3H2,(H,12,13,14) |
| InChIKey | OMQDPHDXIQSSEG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|