C5H5NO7S — CID 140642437
sulfo 2,5-dioxopyrrolidine-1-carboxylate (PubChem CID 140642437) has the molecular formula C5H5NO7S and a molecular weight of 223.16 g/mol. Its IUPAC name is sulfo 2,5-dioxopyrrolidine-1-carboxylate.
| Compound Name | sulfo 2,5-dioxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140642437 |
| Molecular Formula | C5H5NO7S |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | sulfo 2,5-dioxopyrrolidine-1-carboxylate |
| SMILES | O=C1CCC(=O)N1C(=O)OS(=O)(=O)O |
| InChI | InChI=1S/C5H5NO7S/c7-3-1-2-4(8)6(3)5(9)13-14(10,11)12/h1-2H2,(H,10,11,12) |
| InChIKey | KXKPCIYPNSZZIW-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|