C6H6N2O6 — CID 141261019
carbamoyl 2,5-dioxopyrrolidine-1-carboperoxoate (PubChem CID 141261019) has the molecular formula C6H6N2O6 and a molecular weight of 202.12 g/mol. Its IUPAC name is carbamoyl 2,5-dioxopyrrolidine-1-carboperoxoate.
| Compound Name | carbamoyl 2,5-dioxopyrrolidine-1-carboperoxoate |
|---|---|
| PubChem CID | 141261019 |
| Molecular Formula | C6H6N2O6 |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | carbamoyl 2,5-dioxopyrrolidine-1-carboperoxoate |
| SMILES | NC(=O)OOC(=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C6H6N2O6/c7-5(11)13-14-6(12)8-3(9)1-2-4(8)10/h1-2H2,(H2,7,11) |
| InChIKey | UHXKQYBBIFDXEY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|