C18H26N2O7 — CID 159060589
1-(2,2-dimethylpropanoyl)pyrrolidine-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylpropanoate (PubChem CID 159060589) has the molecular formula C18H26N2O7 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)pyrrolidine-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylpropanoate.
| Compound Name | 1-(2,2-dimethylpropanoyl)pyrrolidine-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159060589 |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)pyrrolidine-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)N1C(=O)CCC1=O.CC(C)(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO4.C9H13NO3/c1-9(2,3)8(13)14-10-6(11)4-5-7(10)12;1-9(2,3)8(13)10-6(11)4-5-7(10)12/h4-5H2,1-3H3;4-5H2,1-3H3 |
| InChIKey | JYKLBXPVKFICQO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|