C12H19NO4 — CID 134576769
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylhexanoate (PubChem CID 134576769) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethylhexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 134576769 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethylhexanoate |
| SMILES | CCCCC(C)(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H19NO4/c1-4-5-8-12(2,3)11(16)17-13-9(14)6-7-10(13)15/h4-8H2,1-3H3 |
| InChIKey | IJVVZLQPKYVSOV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|