C22H36N4O8S — CID 177151691
(3aR)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-(pentanoylamino)ethylperoxy]butanoate (PubChem CID 177151691) has the molecular formula C22H36N4O8S and a molecular weight of 516.62 g/mol. Its IUPAC name is (3aR)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-(pentanoylamino)ethylperoxy]butanoate.
| Compound Name | (3aR)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-(pentanoylamino)ethylperoxy]butanoate |
|---|---|
| PubChem CID | 177151691 |
| Molecular Formula | C22H36N4O8S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (3aR)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-(pentanoylamino)ethylperoxy]butanoate |
| SMILES | CCCCC(=O)NCCOOCCC(C)(C)C(=O)ON1C(=O)CCC1=O.O=C1NC2CSC[C@@H]2N1 |
| InChI | InChI=1S/C17H28N2O7.C5H8N2OS/c1-4-5-6-13(20)18-10-12-25-24-11-9-17(2,3)16(23)26-19-14(21)7-8-15(19)22;8-5-6-3-1-9-2-4(3)7-5/h4-12H2,1-3H3,(H,18,20);3-4H,1-2H2,(H2,6,7,8)/t;3-,4?/m.0/s1 |
| InChIKey | CUIWUOAAOOXGPN-PIVIYIDZSA-N |
| XLogP | 1.05 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|