C24H37N3O8 — CID 143320996
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]butan-2-yl]oxybutanoate (PubChem CID 143320996) has the molecular formula C24H37N3O8 and a molecular weight of 495.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]butan-2-yl]oxybutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]butan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 143320996 |
| Molecular Formula | C24H37N3O8 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]butan-2-yl]oxybutanoate |
| SMILES | CN(CCCC(=O)NCCC(C)(C)OCCC(C)(C)C(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C24H37N3O8/c1-23(2,22(33)35-27-20(31)10-11-21(27)32)13-17-34-24(3,4)12-14-25-18(29)8-6-15-26(5)19(30)9-7-16-28/h7,9,16H,6,8,10-15,17H2,1-5H3,(H,25,29)/b9-7- |
| InChIKey | LZUGKCHEJSGIJS-CLFYSBASSA-N |
| XLogP | 1.31 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|