C23H35N3O8 — CID 134221525
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]butan-2-yl]oxybutanoate (PubChem CID 134221525) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]butan-2-yl]oxybutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]butan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 134221525 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[2-methyl-4-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]butan-2-yl]oxybutanoate |
| SMILES | CN(CCC(=O)NCCC(C)(C)OCCC(C)(C)C(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C23H35N3O8/c1-22(2,21(32)34-26-19(30)8-9-20(26)31)12-16-33-23(3,4)11-13-24-17(28)10-14-25(5)18(29)7-6-15-27/h6-7,15H,8-14,16H2,1-5H3,(H,24,28)/b7-6- |
| InChIKey | YFJGFHQWFBLVJJ-SREVYHEPSA-N |
| XLogP | 0.92 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|