C15H21N3O8S — CID 166854633
(2,5-dioxopyrrolidin-1-yl) 3-[2-[methyl-[(Z)-4-oxobut-2-enoyl]amino]ethyl-methylsulfonylamino]propanoate (PubChem CID 166854633) has the molecular formula C15H21N3O8S and a molecular weight of 403.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[methyl-[(Z)-4-oxobut-2-enoyl]amino]ethyl-methylsulfonylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[methyl-[(Z)-4-oxobut-2-enoyl]amino]ethyl-methylsulfonylamino]propanoate |
|---|---|
| PubChem CID | 166854633 |
| Molecular Formula | C15H21N3O8S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[methyl-[(Z)-4-oxobut-2-enoyl]amino]ethyl-methylsulfonylamino]propanoate |
| SMILES | CN(CCN(CCC(=O)ON1C(=O)CCC1=O)S(C)(=O)=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C15H21N3O8S/c1-16(12(20)4-3-11-19)9-10-17(27(2,24)25)8-7-15(23)26-18-13(21)5-6-14(18)22/h3-4,11H,5-10H2,1-2H3/b4-3- |
| InChIKey | KIMVMIUKNSWFSK-ARJAWSKDSA-N |
| XLogP | -1.54 |
| TPSA | 138.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|