C12H19N3O8S — CID 149480299
[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(propanoylamino)ethyl]sulfamic acid (PubChem CID 149480299) has the molecular formula C12H19N3O8S and a molecular weight of 365.36 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(propanoylamino)ethyl]sulfamic acid.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(propanoylamino)ethyl]sulfamic acid |
|---|---|
| PubChem CID | 149480299 |
| Molecular Formula | C12H19N3O8S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(propanoylamino)ethyl]sulfamic acid |
| SMILES | CCC(=O)NCCN(CCC(=O)ON1C(=O)CCC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C12H19N3O8S/c1-2-9(16)13-6-8-14(24(20,21)22)7-5-12(19)23-15-10(17)3-4-11(15)18/h2-8H2,1H3,(H,13,16)(H,20,21,22) |
| InChIKey | ZDCQUASXPJIIET-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|