C12H17IN2O8S — CID 158562223
[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-(5-iodo-4-oxopentyl)sulfamic acid (PubChem CID 158562223) has the molecular formula C12H17IN2O8S and a molecular weight of 476.25 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-(5-iodo-4-oxopentyl)sulfamic acid.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-(5-iodo-4-oxopentyl)sulfamic acid |
|---|---|
| PubChem CID | 158562223 |
| Molecular Formula | C12H17IN2O8S |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-(5-iodo-4-oxopentyl)sulfamic acid |
| SMILES | O=C(CI)CCCN(CCC(=O)ON1C(=O)CCC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C12H17IN2O8S/c13-8-9(16)2-1-6-14(24(20,21)22)7-5-12(19)23-15-10(17)3-4-11(15)18/h1-8H2,(H,20,21,22) |
| InChIKey | WFKQQWDZGLUHPD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|