C12H18N2O6 — CID 139501781
(2,5-dioxopyrrolidin-1-yl) 3-[acetyl(1-methoxyethyl)amino]propanoate (PubChem CID 139501781) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[acetyl(1-methoxyethyl)amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[acetyl(1-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 139501781 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[acetyl(1-methoxyethyl)amino]propanoate |
| SMILES | COC(C)N(CCC(=O)ON1C(=O)CCC1=O)C(C)=O |
| InChI | InChI=1S/C12H18N2O6/c1-8(15)13(9(2)19-3)7-6-12(18)20-14-10(16)4-5-11(14)17/h9H,4-7H2,1-3H3 |
| InChIKey | GYGRVHRWQCQRSI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|