C9H16ClN3O6 — CID 131724605
N,N-dimethylformamide;(2,5-dioxopyrrolidin-1-yl) 2-aminooxyacetate;hydrochloride (PubChem CID 131724605) has the molecular formula C9H16ClN3O6 and a molecular weight of 297.69 g/mol. Its IUPAC name is N,N-dimethylformamide;(2,5-dioxopyrrolidin-1-yl) 2-aminooxyacetate;hydrochloride.
| Compound Name | N,N-dimethylformamide;(2,5-dioxopyrrolidin-1-yl) 2-aminooxyacetate;hydrochloride |
|---|---|
| PubChem CID | 131724605 |
| Molecular Formula | C9H16ClN3O6 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N,N-dimethylformamide;(2,5-dioxopyrrolidin-1-yl) 2-aminooxyacetate;hydrochloride |
| SMILES | CN(C)C=O.Cl.NOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C6H8N2O5.C3H7NO.ClH/c7-12-3-6(11)13-8-4(9)1-2-5(8)10;1-4(2)3-5;/h1-3,7H2;3H,1-2H3;1H |
| InChIKey | CCSHBPBSDNJMMV-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|