C27H57N7O3S — CID 144667878
1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butanoylamino)hexanamide;ethane (PubChem CID 144667878) has the molecular formula C27H57N7O3S and a molecular weight of 559.87 g/mol. Its IUPAC name is 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butanoylamino)hexanamide;ethane.
| Compound Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butanoylamino)hexanamide;ethane |
|---|---|
| PubChem CID | 144667878 |
| Molecular Formula | C27H57N7O3S |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 559.42 |
| IUPAC Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(butanoylamino)hexanamide;ethane |
| SMILES | CC.CCCC(=O)NCCCCCC(=O)NCCCNCCCCNCCCN.O=C1NC2CSCC2N1 |
| InChI | InChI=1S/C20H43N5O2.C5H8N2OS.C2H6/c1-2-10-19(26)24-17-5-3-4-11-20(27)25-18-9-16-23-14-7-6-13-22-15-8-12-21;8-5-6-3-1-9-2-4(3)7-5;1-2/h22-23H,2-18,21H2,1H3,(H,24,26)(H,25,27);3-4H,1-2H2,(H2,6,7,8);1-2H3 |
| InChIKey | DJACXUHKJYCEGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 149.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|