C24H52N6O2 — CID 178155005
2-amino-N-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-2,4,4-trimethylpentanamide (PubChem CID 178155005) has the molecular formula C24H52N6O2 and a molecular weight of 456.72 g/mol. Its IUPAC name is 2-amino-N-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-2,4,4-trimethylpentanamide.
| Compound Name | 2-amino-N-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-2,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 178155005 |
| Molecular Formula | C24H52N6O2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 2-amino-N-[6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]-2,4,4-trimethylpentanamide |
| SMILES | CC(C)(C)CC(C)(N)C(=O)NCCCCCC(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C24H52N6O2/c1-23(2,3)20-24(4,26)22(32)30-18-7-5-6-12-21(31)29-19-11-17-28-15-9-8-14-27-16-10-13-25/h27-28H,5-20,25-26H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | JUVQQGZUGGDPFL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|