C23H40F3N5O5S — CID 15603995
6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-(5-aminopentyl)hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 15603995) has the molecular formula C23H40F3N5O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-(5-aminopentyl)hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-(5-aminopentyl)hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 15603995 |
| Molecular Formula | C23H40F3N5O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-(5-aminopentyl)hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCCCNC(=O)CCCCCNC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H39N5O3S.C2HF3O2/c22-12-6-2-8-14-24-18(27)10-3-1-7-13-23-19(28)11-5-4-9-17-20-16(15-30-17)25-21(29)26-20;3-2(4,5)1(6)7/h16-17,20H,1-15,22H2,(H,23,28)(H,24,27)(H2,25,26,29);(H,6,7)/t16-,17?,20-;/m0./s1 |
| InChIKey | VBADGRRGBWPZBC-FPPMTWIHSA-N |
| XLogP | 2.27 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|