C18H29F3N4O4S — CID 21029191
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propyl]pentanamide (PubChem CID 21029191) has the molecular formula C18H29F3N4O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 21029191 |
| Molecular Formula | C18H29F3N4O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]propyl]pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCCOCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H29F3N4O4S/c19-18(20,21)16(27)23-8-4-10-29-9-3-7-22-14(26)6-2-1-5-13-15-12(11-30-13)24-17(28)25-15/h12-13,15H,1-11H2,(H,22,26)(H,23,27)(H2,24,25,28) |
| InChIKey | VFCVNVBMSMJHGG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|