C17H26N4O5S — CID 146250411
N-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 146250411) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 146250411 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCCON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H26N4O5S/c22-13(18-8-3-9-26-21-14(23)6-7-15(21)24)5-2-1-4-12-16-11(10-27-12)19-17(25)20-16/h11-12,16H,1-10H2,(H,18,22)(H2,19,20,25) |
| InChIKey | OOVXBBJQLCTMEW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|