C17H38N2O2S — CID 142615492
1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane;hexan-2-one (PubChem CID 142615492) has the molecular formula C17H38N2O2S and a molecular weight of 334.57 g/mol. Its IUPAC name is 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane;hexan-2-one.
| Compound Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane;hexan-2-one |
|---|---|
| PubChem CID | 142615492 |
| Molecular Formula | C17H38N2O2S |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane;hexan-2-one |
| SMILES | CC.CC.CC.CCCCC(C)=O.O=C1NC2CSCC2N1 |
| InChI | InChI=1S/C6H12O.C5H8N2OS.3C2H6/c1-3-4-5-6(2)7;8-5-6-3-1-9-2-4(3)7-5;3*1-2/h3-5H2,1-2H3;3-4H,1-2H2,(H2,6,7,8);3*1-2H3 |
| InChIKey | QIQKSHNMRWYYNF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|