C25H40N2O7 — CID 58918098
1-O-butyl 7-O-(2,5-dioxopyrrolidin-1-yl) 2-ethyl-2,4,6,6-tetramethyl-4-(2-oxopyrrolidin-1-yl)heptanedioate (PubChem CID 58918098) has the molecular formula C25H40N2O7 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-O-butyl 7-O-(2,5-dioxopyrrolidin-1-yl) 2-ethyl-2,4,6,6-tetramethyl-4-(2-oxopyrrolidin-1-yl)heptanedioate.
| Compound Name | 1-O-butyl 7-O-(2,5-dioxopyrrolidin-1-yl) 2-ethyl-2,4,6,6-tetramethyl-4-(2-oxopyrrolidin-1-yl)heptanedioate |
|---|---|
| PubChem CID | 58918098 |
| Molecular Formula | C25H40N2O7 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 1-O-butyl 7-O-(2,5-dioxopyrrolidin-1-yl) 2-ethyl-2,4,6,6-tetramethyl-4-(2-oxopyrrolidin-1-yl)heptanedioate |
| SMILES | CCCCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)ON1C(=O)CCC1=O)N1CCCC1=O |
| InChI | InChI=1S/C25H40N2O7/c1-7-9-15-33-22(32)24(5,8-2)17-25(6,26-14-10-11-18(26)28)16-23(3,4)21(31)34-27-19(29)12-13-20(27)30/h7-17H2,1-6H3 |
| InChIKey | UPLDHIDTKZQOIF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|