C17H33NO — CID 91559137
1-(3-ethyl-3,5-dimethylnonan-5-yl)pyrrolidin-2-one (PubChem CID 91559137) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(3-ethyl-3,5-dimethylnonan-5-yl)pyrrolidin-2-one.
| Compound Name | 1-(3-ethyl-3,5-dimethylnonan-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91559137 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-(3-ethyl-3,5-dimethylnonan-5-yl)pyrrolidin-2-one |
| SMILES | CCCCC(C)(CC(C)(CC)CC)N1CCCC1=O |
| InChI | InChI=1S/C17H33NO/c1-6-9-12-17(5,14-16(4,7-2)8-3)18-13-10-11-15(18)19/h6-14H2,1-5H3 |
| InChIKey | QNHFJGHFFMEZIB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |