C5H5NO2S2 — CID 10552626
2,5-dioxopyrrolidine-1-carbodithioic acid (PubChem CID 10552626) has the molecular formula C5H5NO2S2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,5-dioxopyrrolidine-1-carbodithioic acid.
| Compound Name | 2,5-dioxopyrrolidine-1-carbodithioic acid |
|---|---|
| PubChem CID | 10552626 |
| Molecular Formula | C5H5NO2S2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 174.98 |
| IUPAC Name | 2,5-dioxopyrrolidine-1-carbodithioic acid |
| SMILES | O=C1CCC(=O)N1C(=S)S |
| InChI | InChI=1S/C5H5NO2S2/c7-3-1-2-4(8)6(3)5(9)10/h1-2H2,(H,9,10) |
| InChIKey | XYQYGPCOEVZSKB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|