C12H11NO2S — CID 121008611
1-(benzenecarbonothioyl)piperidine-2,6-dione (PubChem CID 121008611) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-(benzenecarbonothioyl)piperidine-2,6-dione.
| Compound Name | 1-(benzenecarbonothioyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 121008611 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-(benzenecarbonothioyl)piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1C(=S)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2S/c14-10-7-4-8-11(15)13(10)12(16)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | XBBYEFULGLSRRA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|