C12H10N2O5 — CID 11108124
1-(2-nitrobenzoyl)piperidine-2,6-dione (PubChem CID 11108124) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 1-(2-nitrobenzoyl)piperidine-2,6-dione.
| Compound Name | 1-(2-nitrobenzoyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 11108124 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-(2-nitrobenzoyl)piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N2O5/c15-10-6-3-7-11(16)13(10)12(17)8-4-1-2-5-9(8)14(18)19/h1-2,4-5H,3,6-7H2 |
| InChIKey | OSCFWOPLMHYBFD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|