C24H22N2O4S4Sn — CID 15970013
dibenzyltin(2+);bis(2,5-dioxopyrrolidine-1-carbodithioate) (PubChem CID 15970013) has the molecular formula C24H22N2O4S4Sn and a molecular weight of 649.43 g/mol. Its IUPAC name is dibenzyltin(2+);bis(2,5-dioxopyrrolidine-1-carbodithioate).
| Compound Name | dibenzyltin(2+);bis(2,5-dioxopyrrolidine-1-carbodithioate) |
|---|---|
| PubChem CID | 15970013 |
| Molecular Formula | C24H22N2O4S4Sn |
| Molecular Weight | 649.43 g/mol |
| Exact Mass | 649.95 |
| IUPAC Name | dibenzyltin(2+);bis(2,5-dioxopyrrolidine-1-carbodithioate) |
| SMILES | O=C1CCC(=O)N1C(=S)[S-].O=C1CCC(=O)N1C(=S)[S-].c1ccc(C[Sn+2]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C7H7.2C5H5NO2S2.Sn/c2*1-7-5-3-2-4-6-7;2*7-3-1-2-4(8)6(3)5(9)10;/h2*2-6H,1H2;2*1-2H2,(H,9,10);/q;;;;+2/p-2 |
| InChIKey | VHLWNLQUPQYVQH-UHFFFAOYSA-L |
| XLogP | 3.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|