C20H20O4Sn — CID 22463063
dibenzyltin(2+);(Z)-2,3-dimethylbut-2-enedioate (PubChem CID 22463063) has the molecular formula C20H20O4Sn and a molecular weight of 443.09 g/mol. Its IUPAC name is dibenzyltin(2+);(Z)-2,3-dimethylbut-2-enedioate.
| Compound Name | dibenzyltin(2+);(Z)-2,3-dimethylbut-2-enedioate |
|---|---|
| PubChem CID | 22463063 |
| Molecular Formula | C20H20O4Sn |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | dibenzyltin(2+);(Z)-2,3-dimethylbut-2-enedioate |
| SMILES | C/C(C(=O)[O-])=C(\C)C(=O)[O-].c1ccc(C[Sn+2]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C7H7.C6H8O4.Sn/c2*1-7-5-3-2-4-6-7;1-3(5(7)8)4(2)6(9)10;/h2*2-6H,1H2;1-2H3,(H,7,8)(H,9,10);/q;;;+2/p-2/b;;4-3-; |
| InChIKey | HEMGTTOUXLIEPG-DVACKJPTSA-L |
| XLogP | 0.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|